CAS 520-12-7 appears in our catalog under these names: Scutellarein-6,4'-dimethyl Ether, Pectolinarigenin, Pectolinarigenin/ 98.77% (existing batch purity), Pectolinarigenin 96%, Pectolinarigenin, 96%, 96%. Offered by: TRC, GLPBio, TargetMol, Ambeed, Chemat. Available pack sizes: 10mg, 20mg, 5mg, 1mg, 25mg, 50mg, 100mg, Get quote.
5,7-dihydroxy-6-methoxy-2-(4-methoxyphenyl)chromen-4-one (CAS 520-12-7) is a chemical compound with the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. IUPAC name: 5,7-dihydroxy-6-methoxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: GPQLHGCIAUEJQK-UHFFFAOYSA-N.
| Molecular formula | C17H14O6 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | 5,7-dihydroxy-6-methoxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | GPQLHGCIAUEJQK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C(=C3O)OC)O |
Computed by PubChem (NCBI)