cas: 3366-65-2 — see every product listed under this CAS number, including other names
Phenanthren-2-amine, 97%, 97% (CAS 3366-65-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C8B6-100mg |
| cas | 3366-65-2 |
| size | 100mg |
| availability | 1.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 645.20 Pln | |
| Chemat | 1g | 1811.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Phenanthren-2-amine (CAS 3366-65-2) is a chemical compound with the molecular formula C14H11N and a molecular weight of 193.24 g/mol. IUPAC name: phenanthren-2-amine. InChIKey: ZEAWSFHWVLOENK-UHFFFAOYSA-N.
| Molecular formula | C14H11N |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | phenanthren-2-amine |
| InChIKey | ZEAWSFHWVLOENK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC(=C3)N |
Computed by PubChem (NCBI)