cas: 52890-52-5 — see every product listed under this CAS number, including other names
Phenyl(2,4,5-trimethylphenyl)methanone, 95%, 95% (CAS 52890-52-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FM7-100mg |
| cas | 52890-52-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 990.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Phenyl-(2,4,5-trimethylphenyl)methanone (CAS 52890-52-5) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: phenyl-(2,4,5-trimethylphenyl)methanone. InChIKey: FTPZYWUJDVZEIE-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | phenyl-(2,4,5-trimethylphenyl)methanone |
| InChIKey | FTPZYWUJDVZEIE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)C(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)