cas: 138184-36-8 — see every product listed under this CAS number, including other names
Poly(2–methoxy–5–(2–ethylhexyloxy)–1,4–phenylenevinylene) (CAS 138184-36-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 50mg, 500mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB60520-100 |
| cas | 138184-36-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 1102.53 Pln | |
| GLPBio | 1g | 7112.30 Pln | |
| GLPBio | 250mg | 2132.24 Pln | |
| GLPBio | 50mg | 760.86 Pln | |
| GLPBio | 500mg | 3849.99 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-ethenyl-1-(2-ethylhexoxy)-4-methoxybenzene (CAS 138184-36-8) is a chemical compound with the molecular formula C17H26O2 and a molecular weight of 262.4 g/mol. IUPAC name: 2-ethenyl-1-(2-ethylhexoxy)-4-methoxybenzene. InChIKey: XBPRNYAUPOCWFS-UHFFFAOYSA-N.
| Molecular formula | C17H26O2 |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | 2-ethenyl-1-(2-ethylhexoxy)-4-methoxybenzene |
| InChIKey | XBPRNYAUPOCWFS-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC1=C(C=C(C=C1)OC)C=C |
Computed by PubChem (NCBI)