cas: 138184-36-8 — see every product listed under this CAS number, including other names
Poly(2-Methoxy-5-(2-ethylhexyloxy)-1,4-phenylenevinylene), average Mn 150,000-250,000 (CAS 138184-36-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1454975-1g |
| cas | 138184-36-8 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 4171.30 Pln |
| purity | average Mn 150,000-250,000 |
|---|---|
| delivery time | To be confirmed by Chemat |
2-ethenyl-1-(2-ethylhexoxy)-4-methoxybenzene (CAS 138184-36-8) is a chemical compound with the molecular formula C17H26O2 and a molecular weight of 262.4 g/mol. IUPAC name: 2-ethenyl-1-(2-ethylhexoxy)-4-methoxybenzene. InChIKey: XBPRNYAUPOCWFS-UHFFFAOYSA-N.
| Molecular formula | C17H26O2 |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | 2-ethenyl-1-(2-ethylhexoxy)-4-methoxybenzene |
| InChIKey | XBPRNYAUPOCWFS-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC1=C(C=C(C=C1)OC)C=C |
Computed by PubChem (NCBI)