Products 908608-06-0
CAS 908608-06-0 appears in our catalog under these names: Potassium Channel Activator 1/ 99.6% (existing batch purity), Carbamic acid, Potassium Channel Activator 1, Potassium Channel Activator 1, 98.43%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 50 mg, 5 mg.
Benzyl N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)carbamate (CAS 908608-06-0) is a chemical compound with the molecular formula C19H23N3O3 and a molecular weight of 341.4 g/mol. IUPAC name: benzyl N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)carbamate. InChIKey: KAEMILXLUFFLSU-UHFFFAOYSA-N.
| Molecular formula | C19H23N3O3 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | benzyl N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)carbamate |
| InChIKey | KAEMILXLUFFLSU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1NC(=O)OCC2=CC=CC=C2)C)N3CCOCC3 |
Computed by PubChem (NCBI)