CAS 61596-47-2 appears in our catalog under these names: Prolylleucine/ 98.67% (existing batch purity), Prolylleucine, Prolylleucine, 98.67% ,, 98.67% ,, Prolylleucine, 99.85%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 500mg, 10mg, 10mM (in 1ml dmso), 5mg, 200mg.
(2R)-4-methyl-2-[[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]amino]pentanoic acid (CAS 61596-47-2) is a chemical compound with the molecular formula C19H26N2O5 and a molecular weight of 362.4 g/mol. IUPAC name: (2R)-4-methyl-2-[[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]amino]pentanoic acid. InChIKey: YCYXUKRYYSXSLJ-CVEARBPZSA-N.
| Molecular formula | C19H26N2O5 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | (2R)-4-methyl-2-[[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]amino]pentanoic acid |
| InChIKey | YCYXUKRYYSXSLJ-CVEARBPZSA-N |
| SMILES | CC(C)C[C@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)