Propanedioic acid, 2-phenyl-, 1,3-diethyl ester, 98%, 98%
cas: 83-13-6 — see every product listed under this CAS number, including other names
Propanedioic acid, 2-phenyl-, 1,3-diethyl ester, 98%, 98% (CAS 83-13-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 50g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115W1D-5g |
| cas | 83-13-6 |
| size | 5g |
| availability | 2000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 102.80 Pln | |
| Chemat | 100g | 112.40 Pln | |
| Chemat | 500g | 379.20 Pln | |
| Chemat | 1kg | 664.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Diethyl 2-phenylpropanedioate (CAS 83-13-6) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: diethyl 2-phenylpropanedioate. InChIKey: FGYDHYCFHBSNPE-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | diethyl 2-phenylpropanedioate |
| InChIKey | FGYDHYCFHBSNPE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=CC=C1)C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
Diethyl phenylmalonate, Propanedioic acid, phenyl-, diethyl ester, Phenylmalonic acid diethyl ester, Malonic acid, phenyl-, diethyl ester, Malonic acid, phenyl, diethyl ester, Propanedioic acid, phenyl, diethyl ester, Malonic acid, phenyl, diethyl ester (8CI), Propanedioic acid, 2phenyl, 1,3diethyl ester, FGYDHYCFHBSNPE-UHFFFAOYSA-N, Malonic acid, phenyl-, diethyl ester (8CI)