cas: 1174157-65-3 — see every product listed under this CAS number, including other names
Propargyl-PEG1-NHS ester, 98%, 98% (CAS 1174157-65-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111E0H-50mg |
| cas | 1174157-65-3 |
| size | 50mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 213.20 Pln | |
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 808.40 Pln | |
| Chemat | 5g | 1955.60 Pln | |
| Chemat | 10g | 3386.00 Pln | |
| Chemat | 25g | 7446.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-prop-2-ynoxypropanoate (CAS 1174157-65-3) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-prop-2-ynoxypropanoate. InChIKey: WKIKHHMUNOVQLD-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-prop-2-ynoxypropanoate |
| InChIKey | WKIKHHMUNOVQLD-UHFFFAOYSA-N |
| SMILES | C#CCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)