cas: 1174157-65-3 — see every product listed under this CAS number, including other names
Propanoic acid, 3-(2-propyn-1-yloxy)-, 2,5-dioxo-1-pyrrolidinyl ester, 95% (CAS 1174157-65-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F861558-50MG |
| cas | 1174157-65-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 320.74 Pln | |
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 435.28 Pln | |
| Fluorochem | 1g | 1283.94 Pln | |
| Fluorochem | 5g | 3007.29 Pln | |
| Fluorochem | 10g | 5964.58 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-prop-2-ynoxypropanoate (CAS 1174157-65-3) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-prop-2-ynoxypropanoate. InChIKey: WKIKHHMUNOVQLD-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-prop-2-ynoxypropanoate |
| InChIKey | WKIKHHMUNOVQLD-UHFFFAOYSA-N |
| SMILES | C#CCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)