cas: 1174157-65-3 — see every product listed under this CAS number, including other names
Propargyl-PEG1-NHS ester, 98.0% (CAS 1174157-65-3) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 25 mg, 50 mg, 100 mg, 1 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-126513-5 g |
| cas | 1174157-65-3 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 4007.03 Pln | |
| MedChemExpress | 25 mg | 361.49 Pln | |
| MedChemExpress | 50 mg | 431.15 Pln | |
| MedChemExpress | 100 mg | 505.45 Pln | |
| MedChemExpress | 1 g | 1680.38 Pln | |
| MedChemExpress | 250 mg | 649.42 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
(2,5-dioxopyrrolidin-1-yl) 3-prop-2-ynoxypropanoate (CAS 1174157-65-3) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-prop-2-ynoxypropanoate. InChIKey: WKIKHHMUNOVQLD-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-prop-2-ynoxypropanoate |
| InChIKey | WKIKHHMUNOVQLD-UHFFFAOYSA-N |
| SMILES | C#CCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)