CAS 86763-47-5 appears in our catalog under these names: Propisochlor, >95% (HPLC), Propisochlor, Propisochlor 10 µg/mL in Cyclohexane, PROPISOCHLOR PESTANAL, Propisochlor, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Sigma-Aldrich, HPC Standards. Available pack sizes: 100mg, 50mg, 10ml, 1x1ml, 1x50mg, 1x10ml.
2-chloro-N-(2-ethyl-6-methylphenyl)-N-(propan-2-yloxymethyl)acetamide (CAS 86763-47-5) is a chemical compound with the molecular formula C15H22ClNO2 and a molecular weight of 283.79 g/mol. IUPAC name: 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(propan-2-yloxymethyl)acetamide. InChIKey: KZNDFYDURHAESM-UHFFFAOYSA-N.
| Molecular formula | C15H22ClNO2 |
|---|---|
| Molecular weight | 283.79 g/mol |
| IUPAC name | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(propan-2-yloxymethyl)acetamide |
| InChIKey | KZNDFYDURHAESM-UHFFFAOYSA-N |
| SMILES | CCC1=CC=CC(=C1N(COC(C)C)C(=O)CCl)C |
Computed by PubChem (NCBI)