Pyrene-2,7-diamine, 95%
cas: 64535-41-7 — see every product listed under this CAS number, including other names
Pyrene-2,7-diamine, 95% (CAS 64535-41-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1520267-100mg |
| cas | 64535-41-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1610.81 Pln | |
| Ambeed | 250mg | 3168.31 Pln | |
| Ambeed | 1g | 7696.19 Pln | |
| Chemat | 50mg | 986.00 Pln | |
| Chemat | 100mg | 1614.80 Pln | |
| Chemat | 250mg | 3179.60 Pln | |
| Chemat | 1g | 7739.60 Pln | |
| BLDpharm | 50mg | 1064.09 Pln | |
| BLDpharm | 100mg | 1730.53 Pln | |
| BLDpharm | 250mg | 3407.71 Pln | |
| BLDpharm | 1g | 8289.33 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Pyrene-2,7-diamine (CAS 64535-41-7) is a chemical compound with the molecular formula C16H12N2 and a molecular weight of 232.28 g/mol. IUPAC name: pyrene-2,7-diamine. InChIKey: JSTHREDTMPIBEX-UHFFFAOYSA-N.
| Molecular formula | C16H12N2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | pyrene-2,7-diamine |
| InChIKey | JSTHREDTMPIBEX-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC3=C2C4=C(C=C3)C=C(C=C41)N)N |
Computed by PubChem (NCBI)