Pyridazine-3,6-dicarboxylic acid 98%
cas: 57266-70-3 — see every product listed under this CAS number, including other names
Pyridazine-3,6-dicarboxylic acid 98% (CAS 57266-70-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A337282-100mg |
| cas | 57266-70-3 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 481.62 Pln | |
| Ambeed | 1g | 1449.50 Pln | |
| Ambeed | 5g | 4892.69 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A337282 |
Pyridazine-3,6-dicarboxylic acid (CAS 57266-70-3) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: pyridazine-3,6-dicarboxylic acid. InChIKey: FJPJFQGISLJONZ-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | pyridazine-3,6-dicarboxylic acid |
| InChIKey | FJPJFQGISLJONZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NN=C1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)