cas: 127527-24-6 — see every product listed under this CAS number, including other names
Pyrimidine-2,5-dicarboxylic acid 95% (CAS 127527-24-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A969336-100mg |
| cas | 127527-24-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 520.56 Pln | |
| Ambeed | 250mg | 871.00 Pln | |
| Ambeed | 1g | 1822.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A969336 |
Pyrimidine-2,5-dicarboxylic acid (CAS 127527-24-6) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: pyrimidine-2,5-dicarboxylic acid. InChIKey: PIVRLVQKXVLRCA-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | pyrimidine-2,5-dicarboxylic acid |
| InChIKey | PIVRLVQKXVLRCA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)