cas: 17257-96-4 — see every product listed under this CAS number, including other names
Pyrimido[4,5-d]pyridazine-2,4(1H,3H)-dione 97% (CAS 17257-96-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A163118-50mg |
| cas | 17257-96-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 776.44 Pln | |
| Ambeed | 100mg | 987.81 Pln | |
| Ambeed | 250mg | 1449.50 Pln | |
| Ambeed | 1g | 3769.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A163118 |
1H-pyrimido[4,5-d]pyridazine-2,4-dione (CAS 17257-96-4) is a chemical compound with the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. IUPAC name: 1H-pyrimido[4,5-d]pyridazine-2,4-dione. InChIKey: OXXOHYAWQSFGSU-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O2 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 1H-pyrimido[4,5-d]pyridazine-2,4-dione |
| InChIKey | OXXOHYAWQSFGSU-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=N1)NC(=O)NC2=O |
Computed by PubChem (NCBI)