CAS 234-95-7 is the registry number for Pyrrolo[1,2-a]quinoxaline, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Pyrrolo[1,2-a]quinoxaline (CAS 234-95-7) is a chemical compound with the molecular formula C11H8N2 and a molecular weight of 168.19 g/mol. IUPAC name: pyrrolo[1,2-a]quinoxaline. InChIKey: IEOUSWADWJLLCH-UHFFFAOYSA-N.
| Molecular formula | C11H8N2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | pyrrolo[1,2-a]quinoxaline |
| InChIKey | IEOUSWADWJLLCH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC3=CC=CN32 |
Computed by PubChem (NCBI)