CAS 72016-73-0 appears in our catalog under these names: 5-Amino-1-naphthonitrile, 95%, 5–Amino–1–naphthonitrile, 5-Amino-1-naphthonitrile, 95%, 95%, 5-Amino-1-naphthonitrile, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
5-aminonaphthalene-1-carbonitrile (CAS 72016-73-0) is a chemical compound with the molecular formula C11H8N2 and a molecular weight of 168.19 g/mol. IUPAC name: 5-aminonaphthalene-1-carbonitrile. InChIKey: COMBRYCXLDMDCU-UHFFFAOYSA-N.
| Molecular formula | C11H8N2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 5-aminonaphthalene-1-carbonitrile |
| InChIKey | COMBRYCXLDMDCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC=C(C2=C1)N)C#N |
Computed by PubChem (NCBI)