CAS 91135-41-0 appears in our catalog under these names: 6-Aminonaphthalene-1-carbonitrile, 95%, 6-Amino-1-naphthonitrile, 97%, 6-Aminonaphthalene-1-carbonitrile, 95%, 95%, 6-AMINO-1-NAPHTHONITRILE, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 500mg, 250mg.
6-aminonaphthalene-1-carbonitrile (CAS 91135-41-0) is a chemical compound with the molecular formula C11H8N2 and a molecular weight of 168.19 g/mol. IUPAC name: 6-aminonaphthalene-1-carbonitrile. InChIKey: KRDRFUMDHDIGIC-UHFFFAOYSA-N.
| Molecular formula | C11H8N2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 6-aminonaphthalene-1-carbonitrile |
| InChIKey | KRDRFUMDHDIGIC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)N)C(=C1)C#N |
Computed by PubChem (NCBI)