CAS 58728-64-6 appears in our catalog under these names: 4-Amino-1-naphthalenecarbonitrile, 97%, 4-Amino-1-naphthonitrile 97%, 4-Amino-1-naphthonitrile, 97%, 97%, 4-Amino-1-naphthonitrile, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
4-aminonaphthalene-1-carbonitrile (CAS 58728-64-6) is a chemical compound with the molecular formula C11H8N2 and a molecular weight of 168.19 g/mol. IUPAC name: 4-aminonaphthalene-1-carbonitrile. InChIKey: LUSIZUFVMKYWGX-UHFFFAOYSA-N.
| Molecular formula | C11H8N2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 4-aminonaphthalene-1-carbonitrile |
| InChIKey | LUSIZUFVMKYWGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2N)C#N |
Computed by PubChem (NCBI)