CAS 233-41-0 is the registry number for 1H-Benzo[g]indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1H-benzo[g]indazole (CAS 233-41-0) is a chemical compound with the molecular formula C11H8N2 and a molecular weight of 168.19 g/mol. IUPAC name: 1H-benzo[g]indazole. InChIKey: JAAGHUBILRENEC-UHFFFAOYSA-N.
| Molecular formula | C11H8N2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 1H-benzo[g]indazole |
| InChIKey | JAAGHUBILRENEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2NN=C3 |
Computed by PubChem (NCBI)