Pyrrolo[1,2-c]pyrimidine-3-carboxylic acid 98%
cas: 251102-27-9 — see every product listed under this CAS number, including other names
Pyrrolo[1,2-c]pyrimidine-3-carboxylic acid 98% (CAS 251102-27-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A583725-100mg |
| cas | 251102-27-9 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 2028.00 Pln | |
| Ambeed | 10g | 3207.25 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A583725 |
Pyrrolo[1,2-c]pyrimidine-3-carboxylic acid (CAS 251102-27-9) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: pyrrolo[1,2-c]pyrimidine-3-carboxylic acid. InChIKey: OAZGQWMFODAEEV-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | pyrrolo[1,2-c]pyrimidine-3-carboxylic acid |
| InChIKey | OAZGQWMFODAEEV-UHFFFAOYSA-N |
| SMILES | C1=CN2C=NC(=CC2=C1)C(=O)O |
Computed by PubChem (NCBI)