cas: 251102-27-9 — see every product listed under this CAS number, including other names
Pyrrolo[1,2-c]pyrimidine-3-carboxylic acid, 98%, 98% (CAS 251102-27-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113QIC-100mg |
| cas | 251102-27-9 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 285.20 Pln | |
| Chemat | 5g | 1182.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Pyrrolo[1,2-c]pyrimidine-3-carboxylic acid (CAS 251102-27-9) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: pyrrolo[1,2-c]pyrimidine-3-carboxylic acid. InChIKey: OAZGQWMFODAEEV-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | pyrrolo[1,2-c]pyrimidine-3-carboxylic acid |
| InChIKey | OAZGQWMFODAEEV-UHFFFAOYSA-N |
| SMILES | C1=CN2C=NC(=CC2=C1)C(=O)O |
Computed by PubChem (NCBI)