Quinocetone, 97%
cas: 81810-66-4 — see every product listed under this CAS number, including other names
Quinocetone, 97% (CAS 81810-66-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1mg, 5mg, 25mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A283041-5g |
| cas | 81810-66-4 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 264.69 Pln | |
| Ambeed | 500g | 598.44 Pln | |
| Chemat | 1mg | 88.40 Pln | |
| Chemat | 5mg | 93.20 Pln | |
| Chemat | 25mg | 98.00 Pln | |
| Chemat | 25g | 117.20 Pln | |
| Chemat | 100g | 194.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)-3-phenylprop-2-en-1-one (CAS 81810-66-4) is a chemical compound with the molecular formula C18H14N2O3 and a molecular weight of 306.3 g/mol. IUPAC name: 1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)-3-phenylprop-2-en-1-one. InChIKey: IOKWXGMNRWVQHX-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O3 |
|---|---|
| Molecular weight | 306.3 g/mol |
| IUPAC name | 1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)-3-phenylprop-2-en-1-one |
| InChIKey | IOKWXGMNRWVQHX-UHFFFAOYSA-N |
| SMILES | CC1=C([N+](=O)C2=CC=CC=C2N1[O-])C(=O)C=CC3=CC=CC=C3 |
Computed by PubChem (NCBI)