Products 81810-66-4
CAS 81810-66-4 appears in our catalog under these names: Quinocetone, Quinocetone/ 99.77% (existing batch purity), Quinocetone 97%, Quinocetone, 97%, 97%, Quinocetone, 98.25%. Offered by: Dr. Ehrenstorfer, TRC, GLPBio, TargetMol, Ambeed. Available pack sizes: 100mg, 1g, 50mg, 500mg, 25mg, 5g, 25g, 100g.
1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)-3-phenylprop-2-en-1-one (CAS 81810-66-4) is a chemical compound with the molecular formula C18H14N2O3 and a molecular weight of 306.3 g/mol. IUPAC name: 1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)-3-phenylprop-2-en-1-one. InChIKey: IOKWXGMNRWVQHX-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O3 |
|---|---|
| Molecular weight | 306.3 g/mol |
| IUPAC name | 1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)-3-phenylprop-2-en-1-one |
| InChIKey | IOKWXGMNRWVQHX-UHFFFAOYSA-N |
| SMILES | CC1=C([N+](=O)C2=CC=CC=C2N1[O-])C(=O)C=CC3=CC=CC=C3 |
Computed by PubChem (NCBI)