Products 1979192-13-6
CAS 1979192-13-6 appears in our catalog under these names: REV7/REV3L-IN-1, 99+%, REV7/REV3L-IN-1, 99.14%, 99.14%, REV7/REV3L-IN-1, 99.14%, REV7/REV3L-IN-1 (Standard). Offered by: AmBeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 100 mg, 10 mg, 50 mg, 5 mg.
3-[(1-acetylpiperidin-4-yl)methyl]-5-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-4-one (CAS 1979192-13-6) is a chemical compound with the molecular formula C19H21N3O3S and a molecular weight of 371.5 g/mol. IUPAC name: 3-[(1-acetylpiperidin-4-yl)methyl]-5-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-4-one. InChIKey: FCAGATFCNDPZOG-UHFFFAOYSA-N.
| Molecular formula | C19H21N3O3S |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | 3-[(1-acetylpiperidin-4-yl)methyl]-5-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-4-one |
| InChIKey | FCAGATFCNDPZOG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)C2=CSC3=C2C(=O)N(C=N3)CC4CCN(CC4)C(=O)C |
Computed by PubChem (NCBI)
Synonyms:
orb1708685