CAS 140405-36-3 appears in our catalog under these names: RSVA 405, RSVA405/ 98.71% (existing batch purity), RSVA 405, Rsva 405, 95%, 95%, RSVA405, 99.72%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg, 2mg, 100mg.
N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]pyridine-4-carboxamide (CAS 140405-36-3) is a chemical compound with the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. IUPAC name: N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]pyridine-4-carboxamide. InChIKey: GWQPCBPAOAFXSJ-XDHOZWIPSA-N.
| Molecular formula | C17H20N4O2 |
|---|---|
| Molecular weight | 312.37 g/mol |
| IUPAC name | N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]pyridine-4-carboxamide |
| InChIKey | GWQPCBPAOAFXSJ-XDHOZWIPSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)/C=N/NC(=O)C2=CC=NC=C2)O |
Computed by PubChem (NCBI)