Products 1016897-10-1
CAS 1016897-10-1 appears in our catalog under these names: RV01/ 98.97% (existing batch purity), RV01, RV01, 98.06%, (E)-5-(2-(Quinolin-4-yl)vinyl)benzene-1,3-diol, 98%, 98%. Offered by: TargetMol, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM/1mL.
5-[(E)-2-quinolin-4-ylethenyl]benzene-1,3-diol (CAS 1016897-10-1) is a chemical compound with the molecular formula C17H13NO2 and a molecular weight of 263.29 g/mol. IUPAC name: 5-[(E)-2-quinolin-4-ylethenyl]benzene-1,3-diol. InChIKey: YRSOXYVELWTHAE-AATRIKPKSA-N.
| Molecular formula | C17H13NO2 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 5-[(E)-2-quinolin-4-ylethenyl]benzene-1,3-diol |
| InChIKey | YRSOXYVELWTHAE-AATRIKPKSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)/C=C/C3=CC(=CC(=C3)O)O |
Computed by PubChem (NCBI)