cas: 2022961-17-5 — see every product listed under this CAS number, including other names
Raphin1 99% (CAS 2022961-17-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1216819-1mg |
| cas | 2022961-17-5 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 164.56 Pln | |
| Ambeed | 5mg | 264.69 Pln | |
| Ambeed | 10mg | 320.31 Pln | |
| Ambeed | 25mg | 470.50 Pln | |
| Ambeed | 50mg | 681.88 Pln | |
| Ambeed | 100mg | 1043.44 Pln | |
| Ambeed | 250mg | 1761.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1216819 |
2-[(E)-(2,3-dichlorophenyl)methylideneamino]guanidine (CAS 2022961-17-5) is a chemical compound with the molecular formula C8H8Cl2N4 and a molecular weight of 231.08 g/mol. IUPAC name: 2-[(E)-(2,3-dichlorophenyl)methylideneamino]guanidine. InChIKey: WLTSTDGGFCQWTK-YIXHJXPBSA-N.
| Molecular formula | C8H8Cl2N4 |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | 2-[(E)-(2,3-dichlorophenyl)methylideneamino]guanidine |
| InChIKey | WLTSTDGGFCQWTK-YIXHJXPBSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)/C=N/N=C(N)N |
Computed by PubChem (NCBI)