CAS 2022961-17-5 appears in our catalog under these names: Raphin1, Raphin 1, Raphin1/ 100%, Raphin1 99%, (E)-2-(2,3-Dichlorobenzylidene)hydrazine-1-carboximidamide, 99%, 99%. Offered by: GLPBio, Chemat Brand, TargetMol, Ambeed, Chemat. Available pack sizes: 5mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
2-[(E)-(2,3-dichlorophenyl)methylideneamino]guanidine (CAS 2022961-17-5) is a chemical compound with the molecular formula C8H8Cl2N4 and a molecular weight of 231.08 g/mol. IUPAC name: 2-[(E)-(2,3-dichlorophenyl)methylideneamino]guanidine. InChIKey: WLTSTDGGFCQWTK-YIXHJXPBSA-N.
| Molecular formula | C8H8Cl2N4 |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | 2-[(E)-(2,3-dichlorophenyl)methylideneamino]guanidine |
| InChIKey | WLTSTDGGFCQWTK-YIXHJXPBSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)/C=N/N=C(N)N |
Computed by PubChem (NCBI)