CAS 1630906-67-0 appears in our catalog under these names: 5,7-Dichloro-2-(propan-2-yl)-2h-pyrazolo[4,3-d]pyrimidine, 95%, 5,7-Dichloro-2-isopropyl-2H-pyrazolo[4,3-d]pyrimidine, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg.
5,7-dichloro-2-propan-2-ylpyrazolo[4,3-d]pyrimidine (CAS 1630906-67-0) is a chemical compound with the molecular formula C8H8Cl2N4 and a molecular weight of 231.08 g/mol. IUPAC name: 5,7-dichloro-2-propan-2-ylpyrazolo[4,3-d]pyrimidine. InChIKey: MHAKTMYTHHJMBC-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N4 |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | 5,7-dichloro-2-propan-2-ylpyrazolo[4,3-d]pyrimidine |
| InChIKey | MHAKTMYTHHJMBC-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C2C(=N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)