CAS 2416051-86-8 is the registry number for 2,4-Dichloro-8-isopropylpyrazolo[1,5-a][1,3,5]triazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazine (CAS 2416051-86-8) is a chemical compound with the molecular formula C8H8Cl2N4 and a molecular weight of 231.08 g/mol. IUPAC name: 2,4-dichloro-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazine. InChIKey: DORYUUFGSKKMTD-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N4 |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | 2,4-dichloro-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazine |
| InChIKey | DORYUUFGSKKMTD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C2N=C(N=C(N2N=C1)Cl)Cl |
Computed by PubChem (NCBI)