CAS 1357087-31-0 is the registry number for 5,7-Dichloro-2-propyl-2H-pyrazolo(4,3-d)pyrimidine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
5,7-dichloro-2-propylpyrazolo[4,3-d]pyrimidine (CAS 1357087-31-0) is a chemical compound with the molecular formula C8H8Cl2N4 and a molecular weight of 231.08 g/mol. IUPAC name: 5,7-dichloro-2-propylpyrazolo[4,3-d]pyrimidine. InChIKey: ZOVVYMBBSYYSFC-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N4 |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | 5,7-dichloro-2-propylpyrazolo[4,3-d]pyrimidine |
| InChIKey | ZOVVYMBBSYYSFC-UHFFFAOYSA-N |
| SMILES | CCCN1C=C2C(=N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)