CAS 9001-99-4 appears in our catalog under these names: RNase A, Ribonuclease A, Ribonuclease A, DNase free, 95.00%, Ribonuclease A, 70.00U/mg, RNaseA, Bovine Pancreas 1PC X 10GM. Offered by: GLPBio, TargetMol, Chemat, Biosynth, Sigma-Aldrich. Available pack sizes: 10mg, 50mg, 100mg, 1g, 250mg, 25mg, 500mg, 10GM.
2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid (CAS 9001-99-4) is a chemical compound with the molecular formula C9H14N4O3 and a molecular weight of 226.23 g/mol. IUPAC name: 2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid. InChIKey: CQOVPNPJLQNMDC-UHFFFAOYSA-N.
| Molecular formula | C9H14N4O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid |
| InChIKey | CQOVPNPJLQNMDC-UHFFFAOYSA-N |
| SMILES | C1=C(NC=N1)CC(C(=O)O)NC(=O)CCN |
Computed by PubChem (NCBI)