Products 1222097-72-4
CAS 1222097-72-4 appears in our catalog under these names: S 38093 Hydrochloride, S 38093 HCl/ 99.16% (existing batch purity), S38093 HCl, 4-(3-(Hexahydrocyclopenta[c]pyrrol-2(1H)-yl)propoxy)benzamide hydrochloride, 95%, 95%, S 38093 (hydrochloride). Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 25mg, 2mg, 5mg, 50mg, 100mg, 200mg.
4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]benzamide;hydrochloride (CAS 1222097-72-4) is a chemical compound with the molecular formula C17H25ClN2O2 and a molecular weight of 324.8 g/mol. IUPAC name: 4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]benzamide;hydrochloride. InChIKey: AFSVOZDCVFYWFG-UHFFFAOYSA-N.
| Molecular formula | C17H25ClN2O2 |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | 4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]benzamide;hydrochloride |
| InChIKey | AFSVOZDCVFYWFG-UHFFFAOYSA-N |
| SMILES | C1CC2CN(CC2C1)CCCOC3=CC=C(C=C3)C(=O)N.Cl |
Computed by PubChem (NCBI)