CAS 179258-59-4 appears in our catalog under these names: SB-237376/ 99.41% (existing batch purity), SB-237376 free base, SB-237376 (free base). Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 10 mg, 5 mg.
N-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-4-nitrobenzamide (CAS 179258-59-4) is a chemical compound with the molecular formula C20H25N3O5 and a molecular weight of 387.4 g/mol. IUPAC name: N-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-4-nitrobenzamide. InChIKey: XEAKAKKNLOUHDV-UHFFFAOYSA-N.
| Molecular formula | C20H25N3O5 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | N-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propyl]-4-nitrobenzamide |
| InChIKey | XEAKAKKNLOUHDV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CCNCCCNC(=O)C2=CC=C(C=C2)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)