CAS 882366-16-7 appears in our catalog under these names: SBI-115/ 99.67% (existing batch purity), SBI-115, SBI-115 99%, m-Tolyl 5-chloro-2-(ethylsulfonyl)pyrimidine-4-carboxylate, 99%, 99%, SBI-115, 99.58%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 250mg, 5 mg.
(3-methylphenyl) 5-chloro-2-ethylsulfonylpyrimidine-4-carboxylate (CAS 882366-16-7) is a chemical compound with the molecular formula C14H13ClN2O4S and a molecular weight of 340.8 g/mol. IUPAC name: (3-methylphenyl) 5-chloro-2-ethylsulfonylpyrimidine-4-carboxylate. InChIKey: IJPXOPBVXVPPEW-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O4S |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | (3-methylphenyl) 5-chloro-2-ethylsulfonylpyrimidine-4-carboxylate |
| InChIKey | IJPXOPBVXVPPEW-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=NC=C(C(=N1)C(=O)OC2=CC=CC(=C2)C)Cl |
Computed by PubChem (NCBI)