CAS 1375060-02-8 appears in our catalog under these names: SCFSkp2-IN-2/ 99.28% (existing batch purity), SCFSkp2–IN–2, (E)-N'-(4-(Diethylamino)-2-hydroxybenzylidene)nicotinohydrazide, SCFSkp2-IN-2, 99.01%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg, 200mg.
N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]pyridine-3-carboxamide (CAS 1375060-02-8) is a chemical compound with the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. IUPAC name: N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]pyridine-3-carboxamide. InChIKey: HEUHCTYMFLTWAX-XDHOZWIPSA-N.
| Molecular formula | C17H20N4O2 |
|---|---|
| Molecular weight | 312.37 g/mol |
| IUPAC name | N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]pyridine-3-carboxamide |
| InChIKey | HEUHCTYMFLTWAX-XDHOZWIPSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)/C=N/NC(=O)C2=CN=CC=C2)O |
Computed by PubChem (NCBI)