cas: 345630-40-2 — see every product listed under this CAS number, including other names
SF1670 99% (HPLC) (CAS 345630-40-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A260724-1mg |
| cas | 345630-40-2 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 303.62 Pln | |
| Ambeed | 5mg | 531.69 Pln | |
| Ambeed | 10mg | 665.19 Pln | |
| Ambeed | 25mg | 948.88 Pln | |
| Ambeed | 50mg | 1215.88 Pln |
| purity | 99% (HPLC) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A260724 |
N-(9,10-dioxophenanthren-2-yl)-2,2-dimethylpropanamide (CAS 345630-40-2) is a chemical compound with the molecular formula C19H17NO3 and a molecular weight of 307.3 g/mol. IUPAC name: N-(9,10-dioxophenanthren-2-yl)-2,2-dimethylpropanamide. InChIKey: VZQDDSYKVYARDW-UHFFFAOYSA-N.
| Molecular formula | C19H17NO3 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | N-(9,10-dioxophenanthren-2-yl)-2,2-dimethylpropanamide |
| InChIKey | VZQDDSYKVYARDW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC2=C(C=C1)C3=CC=CC=C3C(=O)C2=O |
Computed by PubChem (NCBI)