CAS 1446311-56-3 appears in our catalog under these names: SMN-C2/ 99.01% (existing batch purity), SMN–C2, SMN-C2, SMN-C2, 98.85%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 100 mg.
3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)-7-[(3S)-4-ethyl-3-methylpiperazin-1-yl]chromen-2-one (CAS 1446311-56-3) is a chemical compound with the molecular formula C24H27N5O2 and a molecular weight of 417.5 g/mol. IUPAC name: 3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)-7-[(3S)-4-ethyl-3-methylpiperazin-1-yl]chromen-2-one. InChIKey: PETSCYDXCUXNIW-INIZCTEOSA-N.
| Molecular formula | C24H27N5O2 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | 3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)-7-[(3S)-4-ethyl-3-methylpiperazin-1-yl]chromen-2-one |
| InChIKey | PETSCYDXCUXNIW-INIZCTEOSA-N |
| SMILES | CCN1CCN(C[C@@H]1C)C2=CC3=C(C=C2)C=C(C(=O)O3)C4=CN5C=C(N=C(C5=N4)C)C |
Computed by PubChem (NCBI)