CAS 346691-38-1 appears in our catalog under these names: C–170, STING-IN-2/ 98.76% (existing batch purity), STING-IN-2 98%, N-(4-Butylphenyl)-5-nitrofuran-2-carboxamide, 98%, 98%, STING-IN-2, 99.71%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 10mM(in 1ml dmso), 50mg, 10mM/1mL, 50 mg.
N-(4-butylphenyl)-5-nitrofuran-2-carboxamide (CAS 346691-38-1) is a chemical compound with the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. IUPAC name: N-(4-butylphenyl)-5-nitrofuran-2-carboxamide. InChIKey: QMVOHFICEFYHMK-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O4 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | N-(4-butylphenyl)-5-nitrofuran-2-carboxamide |
| InChIKey | QMVOHFICEFYHMK-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=C(C=C1)NC(=O)C2=CC=C(O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)