CAS 37019-18-4 appears in our catalog under these names: Sebuthylazine-desethyl, Sebuthylazin-desethyl, Sebuthylazin-desethyl, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, TRC, HPC Standards. Available pack sizes: 250mg, 5g, 1x5ml.
2-N-butan-2-yl-6-chloro-1,3,5-triazine-2,4-diamine (CAS 37019-18-4) is a chemical compound with the molecular formula C7H12ClN5 and a molecular weight of 201.66 g/mol. IUPAC name: 2-N-butan-2-yl-6-chloro-1,3,5-triazine-2,4-diamine. InChIKey: VMYDDULRGBGGBN-UHFFFAOYSA-N.
| Molecular formula | C7H12ClN5 |
|---|---|
| Molecular weight | 201.66 g/mol |
| IUPAC name | 2-N-butan-2-yl-6-chloro-1,3,5-triazine-2,4-diamine |
| InChIKey | VMYDDULRGBGGBN-UHFFFAOYSA-N |
| SMILES | CCC(C)NC1=NC(=NC(=N1)N)Cl |
Computed by PubChem (NCBI)