CAS 204005-46-9 appears in our catalog under these names: SU 5416, >95% (HPLC), Semaxinib/ 99.84% (existing batch purity), SU 5416, SU 5416, >98.0%(HPLC)(T), Semaxinib 98%. Offered by: TRC, TargetMol, Biosynth, TCI, Ambeed. Available pack sizes: 100mg, 10mg, 50mg, 5mg, 25mg, 1mg, 250mg, 1g.
3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one (CAS 204005-46-9) is a chemical compound with the molecular formula C15H14N2O and a molecular weight of 238.28 g/mol. IUPAC name: 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one. InChIKey: WUWDLXZGHZSWQZ-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one |
| InChIKey | WUWDLXZGHZSWQZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1)C=C2C3=CC=CC=C3NC2=O)C |
Computed by PubChem (NCBI)