CAS 220621-39-6 appears in our catalog under these names: Simazine D10, Simazine D10 100 µg/mL in Acetone, Simazine-d10 (diethyl-d10), 99 atom % D, min 98% Chemical Purity, Simazine-d10, >95% (HPLC), Simazine–d10. Offered by: Dr. Ehrenstorfer, CDN, TRC, GLPBio, Sigma-Aldrich. Available pack sizes: 10mg, 1ml, 0,05g, 0,01g, 25mg, 5mg, 1mg, 5 mg.
6-chloro-2-N,4-N-bis(1,1,2,2,2-pentadeuterioethyl)-1,3,5-triazine-2,4-diamine (CAS 220621-39-6) is a chemical compound with the molecular formula C7H12ClN5 and a molecular weight of 211.72 g/mol. IUPAC name: 6-chloro-2-N,4-N-bis(1,1,2,2,2-pentadeuterioethyl)-1,3,5-triazine-2,4-diamine. InChIKey: ODCWYMIRDDJXKW-MWUKXHIBSA-N.
| Molecular formula | C7H12ClN5 |
|---|---|
| Molecular weight | 211.72 g/mol |
| IUPAC name | 6-chloro-2-N,4-N-bis(1,1,2,2,2-pentadeuterioethyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | ODCWYMIRDDJXKW-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NC1=NC(=NC(=N1)Cl)NC([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)