cas: 1038866-43-1 — see every product listed under this CAS number, including other names
Spiro(piperidine-4,3'-pyrrolo(2,3-b)pyridin)-2'(1'H)-one hydrochloride, 98+% (CAS 1038866-43-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A230912-5g |
| cas | 1038866-43-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 25289.74 Pln | |
| AmBeed | 1g | 6371.68 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one;hydrochloride (CAS 1038866-43-1) is a chemical compound with the molecular formula C11H14ClN3O and a molecular weight of 239.70 g/mol. IUPAC name: spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one;hydrochloride. InChIKey: WDNNQCJGUAHMRO-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one;hydrochloride |
| InChIKey | WDNNQCJGUAHMRO-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(NC2=O)N=CC=C3.Cl |
Computed by PubChem (NCBI)