CAS 1189708-48-2 appears in our catalog under these names: 2-[(4-Methoxyphenyl)methyl]-2,3-dihydro-1h-pyrazol-3-imine hydrochloride, 95%, 2-(4-Methoxybenzyl)-1,2-dihydro-3H-pyrazol-3-imine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 250mg, 5g.
2-[(4-methoxyphenyl)methyl]pyrazol-3-amine;hydrochloride (CAS 1189708-48-2) is a chemical compound with the molecular formula C11H14ClN3O and a molecular weight of 239.70 g/mol. IUPAC name: 2-[(4-methoxyphenyl)methyl]pyrazol-3-amine;hydrochloride. InChIKey: LKEUGWIFUNWRQQ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | 2-[(4-methoxyphenyl)methyl]pyrazol-3-amine;hydrochloride |
| InChIKey | LKEUGWIFUNWRQQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C(=CC=N2)N.Cl |
Computed by PubChem (NCBI)