CAS 1185294-67-0 is the registry number for (1-[3-(2-Methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride (CAS 1185294-67-0) is a chemical compound with the molecular formula C11H14ClN3O and a molecular weight of 239.70 g/mol. IUPAC name: 1-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride. InChIKey: RNYBXTJHTZZRFB-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | 1-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride |
| InChIKey | RNYBXTJHTZZRFB-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=NOC(=N2)C(C)N.Cl |
Computed by PubChem (NCBI)