CAS 1185294-74-9 appears in our catalog under these names: (1-[3-(3-Methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl)amine hydrochloride, 95%, 1-(3-(m-Tolyl)-1,2,4-oxadiazol-5-yl)ethanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 50mg, 100mg.
1-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride (CAS 1185294-74-9) is a chemical compound with the molecular formula C11H14ClN3O and a molecular weight of 239.70 g/mol. IUPAC name: 1-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride. InChIKey: ZENMJKGXFHEPFL-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | 1-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride |
| InChIKey | ZENMJKGXFHEPFL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NOC(=N2)C(C)N.Cl |
Computed by PubChem (NCBI)