CAS 67607-61-8 appears in our catalog under these names: H-Dl-trp-nh2 hydrochloride, 95%, D,L-Tryptophanamide Hydrochloride, >95% (HPLC), H–DL–Trp–NH₂ · HCl, H-DL-Trp-NH2.HCl, 98%, 98%, D,L-Tryptophanamide hydrochloride, 99.13%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 2,5g, 500mg, 10g, 100 mg, 250 mg.
2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride (CAS 67607-61-8) is a chemical compound with the molecular formula C11H14ClN3O and a molecular weight of 239.70 g/mol. IUPAC name: 2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride. InChIKey: WOBDANBSEWOYKN-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | 2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride |
| InChIKey | WOBDANBSEWOYKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)N)N.Cl |
Computed by PubChem (NCBI)