cas: 884049-52-9 — see every product listed under this CAS number, including other names
Spiro(piperidine-4,3'-pyrrolo(2,3-b)pyridin)-2'(1'H)-one, 98% (CAS 884049-52-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A545020-1g |
| cas | 884049-52-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 24020.29 Pln | |
| AmBeed | 5g | 29052.52 Pln | |
| AmBeed | 250mg | 9548.56 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one (CAS 884049-52-9) is a chemical compound with the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. IUPAC name: spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one. InChIKey: JFFUXCQOFURYMG-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one |
| InChIKey | JFFUXCQOFURYMG-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(NC2=O)N=CC=C3 |
Computed by PubChem (NCBI)